C16H24O2 — CID 141297619
(E)-2-(3,5-dimethyl-1-adamantyl)but-2-enoic acid (PubChem CID 141297619) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (E)-2-(3,5-dimethyl-1-adamantyl)but-2-enoic acid.
| Compound Name | (E)-2-(3,5-dimethyl-1-adamantyl)but-2-enoic acid |
|---|---|
| PubChem CID | 141297619 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (E)-2-(3,5-dimethyl-1-adamantyl)but-2-enoic acid |
| SMILES | C/C=C(/C(=O)O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C16H24O2/c1-4-12(13(17)18)16-7-11-5-14(2,9-16)8-15(3,6-11)10-16/h4,11H,5-10H2,1-3H3,(H,17,18)/b12-4- |
| InChIKey | HDEZRQPVOKOXPI-QCDXTXTGSA-N |
| XLogP | 4.01 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|