C17H24O — CID 79986474
1-(3,5-dimethyl-1-adamantyl)pent-4-yn-1-one (PubChem CID 79986474) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1-adamantyl)pent-4-yn-1-one.
| Compound Name | 1-(3,5-dimethyl-1-adamantyl)pent-4-yn-1-one |
|---|---|
| PubChem CID | 79986474 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | 1-(3,5-dimethyl-1-adamantyl)pent-4-yn-1-one |
| SMILES | C#CCCC(=O)C12CC3CC(C)(CC(C)(C3)C1)C2 |
| InChI | InChI=1S/C17H24O/c1-4-5-6-14(18)17-9-13-7-15(2,11-17)10-16(3,8-13)12-17/h1,13H,5-12H2,2-3H3 |
| InChIKey | GTULKGALPHYYRL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|