About 3,5-dimethyladamantan-1-amine;methanol
3,5-dimethyladamantan-1-amine;methanol (PubChem CID 175025323) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is 3,5-dimethyladamantan-1-amine;methanol.
Molecular Properties
| Compound Name | 3,5-dimethyladamantan-1-amine;methanol |
| PubChem CID | 175025323 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3,5-dimethyladamantan-1-amine;methanol |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2.CO |
| InChI | InChI=1S/C12H21N.CH4O/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2/h9H,3-8,13H2,1-2H3;2H,1H3 |
| InChIKey | DDRZWPJECHNVQG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3,5-dimethyladamantan-1-amine;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyladamantan-1-amine;methanol?
The IUPAC name of 3,5-dimethyladamantan-1-amine;methanol (CID 175025323) is 3,5-dimethyladamantan-1-amine;methanol.
What is the SMILES notation for 3,5-dimethyladamantan-1-amine;methanol?
The canonical SMILES for 3,5-dimethyladamantan-1-amine;methanol is CC12CC3CC(C)(C1)CC(N)(C3)C2.CO.
What is the InChIKey of 3,5-dimethyladamantan-1-amine;methanol?
The InChIKey is DDRZWPJECHNVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N.CH4O/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2/h9H,3-8,13H2,1-2H3;2H,1H3.
What are the key properties of 3,5-dimethyladamantan-1-amine;methanol?
3,5-dimethyladamantan-1-amine;methanol has a molecular weight of 211.35 g/mol, XLogP of 2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyladamantan-1-amine;methanol is sourced from PubChem (CID 175025323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).