C13H25NO — CID 175025323
3,5-dimethyladamantan-1-amine;methanol (PubChem CID 175025323) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 3,5-dimethyladamantan-1-amine;methanol.
| Compound Name | 3,5-dimethyladamantan-1-amine;methanol |
|---|---|
| PubChem CID | 175025323 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 3,5-dimethyladamantan-1-amine;methanol |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2.CO |
| InChI | InChI=1S/C12H21N.CH4O/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10;1-2/h9H,3-8,13H2,1-2H3;2H,1H3 |
| InChIKey | DDRZWPJECHNVQG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |