About Somantadine
Somantadine (PubChem CID 50234) has the molecular formula C14H25N
and a molecular weight of 207.35 g/mol. Its IUPAC name is 1-(1-adamantyl)-2-methylpropan-2-amine.
Molecular Properties
| Compound Name | Somantadine |
| PubChem CID | 50234 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.35 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | 1-(1-adamantyl)-2-methylpropan-2-amine |
| SMILES | CC(C)(CC12CC3CC(C1)CC(C3)C2)N |
| InChI | InChI=1S/C14H25N/c1-13(2,15)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,3-9,15H2,1-2H3 |
| InChIKey | OWKXRDQRMTVCEX-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 26.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | 225 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze Somantadine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Somantadine?
The IUPAC name of Somantadine (CID 50234) is 1-(1-adamantyl)-2-methylpropan-2-amine.
What is the SMILES notation for Somantadine?
The canonical SMILES for Somantadine is CC(C)(CC12CC3CC(C1)CC(C3)C2)N.
What is the InChIKey of Somantadine?
The InChIKey is OWKXRDQRMTVCEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25N/c1-13(2,15)9-14-6-10-3-11(7-14)5-12(4-10)8-14/h10-12H,3-9,15H2,1-2H3.
What are the key properties of Somantadine?
Somantadine has a molecular weight of 207.35 g/mol, XLogP of 3.70, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Somantadine is sourced from PubChem (CID 50234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).