C12H21N — CID 4054
3,5-dimethyladamantan-1-amine (PubChem CID 4054) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is 3,5-dimethyladamantan-1-amine.
| Compound Name | 3,5-dimethyladamantan-1-amine |
|---|---|
| PubChem CID | 4054 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 3,5-dimethyladamantan-1-amine |
| SMILES | CC12CC3CC(C)(C1)CC(N)(C3)C2 |
| InChI | InChI=1S/C12H21N/c1-10-3-9-4-11(2,6-10)8-12(13,5-9)7-10/h9H,3-8,13H2,1-2H3 |
| InChIKey | BUGYDGFZZOZRHP-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |