(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate

C14H20O4 — CID 141258730

IUPAC(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate
SMILESC=CC(=O)OCC12CC3CC(O)(CC(O)(C3)C1)C2
InChIInChI=1S/C14H20O4/c1-2-11(15)18-9-12-3-10-4-13(16,6-12)8-14(17,5-10)7-12/h2,10,16-17H,1,3-9H2
InChIKeyFLYQJYJSXCKWEI-UHFFFAOYSA-N
MW252.31 g/mol
LogP1.16
Rot. Bonds3

About (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate

(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate (PubChem CID 141258730) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate.

Molecular Properties

Compound Name(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate
PubChem CID141258730
Molecular FormulaC14H20O4
Molecular Weight252.31 g/mol
Exact Mass252.14
IUPAC Name(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate
SMILESC=CC(=O)OCC12CC3CC(O)(CC(O)(C3)C1)C2
InChIInChI=1S/C14H20O4/c1-2-11(15)18-9-12-3-10-4-13(16,6-12)8-14(17,5-10)7-12/h2,10,16-17H,1,3-9H2
InChIKeyFLYQJYJSXCKWEI-UHFFFAOYSA-N
XLogP1.16
TPSA66.76 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.31
LogP ≤ 51.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate?
The IUPAC name of (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate (CID 141258730) is (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate.
What is the SMILES notation for (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate?
The canonical SMILES for (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate is C=CC(=O)OCC12CC3CC(O)(CC(O)(C3)C1)C2.
What is the InChIKey of (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate?
The InChIKey is FLYQJYJSXCKWEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20O4/c1-2-11(15)18-9-12-3-10-4-13(16,6-12)8-14(17,5-10)7-12/h2,10,16-17H,1,3-9H2.
What are the key properties of (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate?
(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate has a molecular weight of 252.31 g/mol, XLogP of 1.16, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate is sourced from PubChem (CID 141258730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).