C14H20O4 — CID 141258730
(3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate (PubChem CID 141258730) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate.
| Compound Name | (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate |
|---|---|
| PubChem CID | 141258730 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl)methyl prop-2-enoate |
| SMILES | C=CC(=O)OCC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C14H20O4/c1-2-11(15)18-9-12-3-10-4-13(16,6-12)8-14(17,5-10)7-12/h2,10,16-17H,1,3-9H2 |
| InChIKey | FLYQJYJSXCKWEI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|