C12H18F3NO7S2 — CID 122661174
(3,5-dihydroxy-1-adamantyl)methyl N-(trifluoromethylsulfonyl)sulfamate (PubChem CID 122661174) has the molecular formula C12H18F3NO7S2 and a molecular weight of 409.40 g/mol. Its IUPAC name is (3,5-dihydroxy-1-adamantyl)methyl N-(trifluoromethylsulfonyl)sulfamate.
| Compound Name | (3,5-dihydroxy-1-adamantyl)methyl N-(trifluoromethylsulfonyl)sulfamate |
|---|---|
| PubChem CID | 122661174 |
| Molecular Formula | C12H18F3NO7S2 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | (3,5-dihydroxy-1-adamantyl)methyl N-(trifluoromethylsulfonyl)sulfamate |
| SMILES | O=S(=O)(NS(=O)(=O)C(F)(F)F)OCC12CC3CC(O)(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C12H18F3NO7S2/c13-12(14,15)24(19,20)16-25(21,22)23-7-9-1-8-2-10(17,4-9)6-11(18,3-8)5-9/h8,16-18H,1-7H2 |
| InChIKey | KEEVZLRERYXCBI-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |