C12H18F3NO3S — CID 130207421
1-adamantylmethyl N-(trifluoromethyl)sulfamate (PubChem CID 130207421) has the molecular formula C12H18F3NO3S and a molecular weight of 313.34 g/mol. Its IUPAC name is 1-adamantylmethyl N-(trifluoromethyl)sulfamate.
| Compound Name | 1-adamantylmethyl N-(trifluoromethyl)sulfamate |
|---|---|
| PubChem CID | 130207421 |
| Molecular Formula | C12H18F3NO3S |
| Molecular Weight | 313.34 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 1-adamantylmethyl N-(trifluoromethyl)sulfamate |
| SMILES | O=S(=O)(NC(F)(F)F)OCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C12H18F3NO3S/c13-12(14,15)16-20(17,18)19-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,16H,1-7H2 |
| InChIKey | ZGYQFMNENKTRQJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|