C12H18F2NO5S2- — CID 58961970
N-(1-adamantylmethyl)-1,1-difluoro-1-oxidoperoxysulfanylmethanesulfonamide (PubChem CID 58961970) has the molecular formula C12H18F2NO5S2- and a molecular weight of 358.41 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-1,1-difluoro-1-oxidoperoxysulfanylmethanesulfonamide.
| Compound Name | N-(1-adamantylmethyl)-1,1-difluoro-1-oxidoperoxysulfanylmethanesulfonamide |
|---|---|
| PubChem CID | 58961970 |
| Molecular Formula | C12H18F2NO5S2- |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.06 |
| IUPAC Name | N-(1-adamantylmethyl)-1,1-difluoro-1-oxidoperoxysulfanylmethanesulfonamide |
| SMILES | O=S(=O)(NCC12CC3CC(CC(C3)C1)C2)C(F)(F)SOO[O-] |
| InChI | InChI=1S/C12H19F2NO5S2/c13-12(14,21-20-19-16)22(17,18)15-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,15-16H,1-7H2/p-1 |
| InChIKey | RPFYHJOZKXCDOG-UHFFFAOYSA-M |
| XLogP | 1.54 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|