C15H18F9NO2S — CID 129294870
N-(1-adamantylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 129294870) has the molecular formula C15H18F9NO2S and a molecular weight of 447.36 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-(1-adamantylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 129294870 |
| Molecular Formula | C15H18F9NO2S |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-(1-adamantylmethyl)-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(NCC12CC3CC(CC(C3)C1)C2)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H18F9NO2S/c16-12(17,14(20,21)22)13(18,19)15(23,24)28(26,27)25-7-11-4-8-1-9(5-11)3-10(2-8)6-11/h8-10,25H,1-7H2 |
| InChIKey | JQUYRIIOZCDSGK-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|