C14H17F3O4 — CID 91144035
[3,5-dihydroxy-2-(trifluoromethyl)-1-adamantyl] prop-2-enoate (PubChem CID 91144035) has the molecular formula C14H17F3O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is [3,5-dihydroxy-2-(trifluoromethyl)-1-adamantyl] prop-2-enoate.
| Compound Name | [3,5-dihydroxy-2-(trifluoromethyl)-1-adamantyl] prop-2-enoate |
|---|---|
| PubChem CID | 91144035 |
| Molecular Formula | C14H17F3O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [3,5-dihydroxy-2-(trifluoromethyl)-1-adamantyl] prop-2-enoate |
| SMILES | C=CC(=O)OC12CC3CC(O)(CC(O)(C3)C1C(F)(F)F)C2 |
| InChI | InChI=1S/C14H17F3O4/c1-2-9(18)21-13-5-8-3-11(19,7-13)6-12(20,4-8)10(13)14(15,16)17/h2,8,10,19-20H,1,3-7H2 |
| InChIKey | QZINYLBNOFRAIW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|