C18H26O5 — CID 22986505
butyl 3-hydroxy-5-prop-2-enoyloxyadamantane-1-carboxylate (PubChem CID 22986505) has the molecular formula C18H26O5 and a molecular weight of 322.40 g/mol. Its IUPAC name is butyl 3-hydroxy-5-prop-2-enoyloxyadamantane-1-carboxylate.
| Compound Name | butyl 3-hydroxy-5-prop-2-enoyloxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 22986505 |
| Molecular Formula | C18H26O5 |
| Molecular Weight | 322.40 g/mol |
| Exact Mass | 322.18 |
| IUPAC Name | butyl 3-hydroxy-5-prop-2-enoyloxyadamantane-1-carboxylate |
| SMILES | C=CC(=O)OC12CC3CC(O)(C1)CC(C(=O)OCCCC)(C3)C2 |
| InChI | InChI=1S/C18H26O5/c1-3-5-6-22-15(20)16-7-13-8-17(21,10-16)12-18(9-13,11-16)23-14(19)4-2/h4,13,21H,2-3,5-12H2,1H3 |
| InChIKey | BIFWEJOVCMAJSI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.40 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|