C18H26O6 — CID 174778002
(2-hydroxy-3-prop-2-enoyloxybutyl) 3-hydroxyadamantane-1-carboxylate (PubChem CID 174778002) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxybutyl) 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxybutyl) 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 174778002 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxybutyl) 3-hydroxyadamantane-1-carboxylate |
| SMILES | C=CC(=O)OC(C)C(O)COC(=O)C12CC3CC(CC(O)(C3)C1)C2 |
| InChI | InChI=1S/C18H26O6/c1-3-15(20)24-11(2)14(19)9-23-16(21)17-5-12-4-13(6-17)8-18(22,7-12)10-17/h3,11-14,19,22H,1,4-10H2,2H3 |
| InChIKey | HWALHVAPKIFXCJ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|