C17H26O4 — CID 90221556
(3-ethyloxetan-3-yl)methyl 3-hydroxyadamantane-1-carboxylate (PubChem CID 90221556) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (3-ethyloxetan-3-yl)methyl 3-hydroxyadamantane-1-carboxylate.
| Compound Name | (3-ethyloxetan-3-yl)methyl 3-hydroxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 90221556 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (3-ethyloxetan-3-yl)methyl 3-hydroxyadamantane-1-carboxylate |
| SMILES | CCC1(COC(=O)C23CC4CC(CC(O)(C4)C2)C3)COC1 |
| InChI | InChI=1S/C17H26O4/c1-2-15(9-20-10-15)11-21-14(18)16-4-12-3-13(5-16)7-17(19,6-12)8-16/h12-13,19H,2-11H2,1H3 |
| InChIKey | CNVOJPSRAFKFRB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |