C24H36O6 — CID 139405841
bis[(2-ethyloxetan-2-yl)methyl] adamantane-1,3-dicarboxylate (PubChem CID 139405841) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is bis[(2-ethyloxetan-2-yl)methyl] adamantane-1,3-dicarboxylate.
| Compound Name | bis[(2-ethyloxetan-2-yl)methyl] adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 139405841 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | bis[(2-ethyloxetan-2-yl)methyl] adamantane-1,3-dicarboxylate |
| SMILES | CCC1(COC(=O)C23CC4CC(C2)CC(C(=O)OCC2(CC)CCO2)(C4)C3)CCO1 |
| InChI | InChI=1S/C24H36O6/c1-3-23(5-7-29-23)15-27-19(25)21-10-17-9-18(11-21)13-22(12-17,14-21)20(26)28-16-24(4-2)6-8-30-24/h17-18H,3-16H2,1-2H3 |
| InChIKey | MOVYCTNSAUVVTJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |