C17H23F2O5- — CID 140669922
2,2-difluoro-3-(3-hydroxyadamantane-1-carbonyl)oxy-4-methylpentanoate (PubChem CID 140669922) has the molecular formula C17H23F2O5- and a molecular weight of 345.36 g/mol. Its IUPAC name is 2,2-difluoro-3-(3-hydroxyadamantane-1-carbonyl)oxy-4-methylpentanoate.
| Compound Name | 2,2-difluoro-3-(3-hydroxyadamantane-1-carbonyl)oxy-4-methylpentanoate |
|---|---|
| PubChem CID | 140669922 |
| Molecular Formula | C17H23F2O5- |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 2,2-difluoro-3-(3-hydroxyadamantane-1-carbonyl)oxy-4-methylpentanoate |
| SMILES | CC(C)C(OC(=O)C12CC3CC(CC(O)(C3)C1)C2)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C17H24F2O5/c1-9(2)12(17(18,19)13(20)21)24-14(22)15-4-10-3-11(5-15)7-16(23,6-10)8-15/h9-12,23H,3-8H2,1-2H3,(H,20,21)/p-1 |
| InChIKey | ZWIJKVBELYIKCL-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 86.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |