C8H11F2O4- — CID 164747278
3-acetyloxy-2,2-difluoro-4-methylpentanoate (PubChem CID 164747278) has the molecular formula C8H11F2O4- and a molecular weight of 209.17 g/mol. Its IUPAC name is 3-acetyloxy-2,2-difluoro-4-methylpentanoate.
| Compound Name | 3-acetyloxy-2,2-difluoro-4-methylpentanoate |
|---|---|
| PubChem CID | 164747278 |
| Molecular Formula | C8H11F2O4- |
| Molecular Weight | 209.17 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 3-acetyloxy-2,2-difluoro-4-methylpentanoate |
| SMILES | CC(=O)OC(C(C)C)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C8H12F2O4/c1-4(2)6(14-5(3)11)8(9,10)7(12)13/h4,6H,1-3H3,(H,12,13)/p-1 |
| InChIKey | BDPLMKKDYKYQED-UHFFFAOYSA-M |
| XLogP | -0.04 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.17 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |