C18H16F12O4 — CID 146607098
bis(1,1,1,3,3,3-hexafluoropropan-2-yl) adamantane-1,3-dicarboxylate (PubChem CID 146607098) has the molecular formula C18H16F12O4 and a molecular weight of 524.30 g/mol. Its IUPAC name is bis(1,1,1,3,3,3-hexafluoropropan-2-yl) adamantane-1,3-dicarboxylate.
| Compound Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) adamantane-1,3-dicarboxylate |
|---|---|
| PubChem CID | 146607098 |
| Molecular Formula | C18H16F12O4 |
| Molecular Weight | 524.30 g/mol |
| Exact Mass | 524.09 |
| IUPAC Name | bis(1,1,1,3,3,3-hexafluoropropan-2-yl) adamantane-1,3-dicarboxylate |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)F)C12CC3CC(C1)CC(C(=O)OC(C(F)(F)F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C18H16F12O4/c19-15(20,21)9(16(22,23)24)33-11(31)13-2-7-1-8(4-13)5-14(3-7,6-13)12(32)34-10(17(25,26)27)18(28,29)30/h7-10H,1-6H2 |
| InChIKey | PKGJORDKHAYAOU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.30 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |