C15H22F2O4 — CID 58341536
2,2-difluoropropyl 3-hydroxy-5-methoxyadamantane-1-carboxylate (PubChem CID 58341536) has the molecular formula C15H22F2O4 and a molecular weight of 304.33 g/mol. Its IUPAC name is 2,2-difluoropropyl 3-hydroxy-5-methoxyadamantane-1-carboxylate.
| Compound Name | 2,2-difluoropropyl 3-hydroxy-5-methoxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 58341536 |
| Molecular Formula | C15H22F2O4 |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2,2-difluoropropyl 3-hydroxy-5-methoxyadamantane-1-carboxylate |
| SMILES | COC12CC3CC(O)(C1)CC(C(=O)OCC(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C15H22F2O4/c1-12(16,17)9-21-11(18)13-3-10-4-14(19,6-13)8-15(5-10,7-13)20-2/h10,19H,3-9H2,1-2H3 |
| InChIKey | MELAMFYLGFCVIY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |