C34H52F4O6 — CID 123259647
2,2-difluoropropyl 3-butoxyadamantane-1-carboxylate;2,2-difluoropropyl 3-ethoxyadamantane-1-carboxylate (PubChem CID 123259647) has the molecular formula C34H52F4O6 and a molecular weight of 632.78 g/mol. Its IUPAC name is 2,2-difluoropropyl 3-butoxyadamantane-1-carboxylate;2,2-difluoropropyl 3-ethoxyadamantane-1-carboxylate.
| Compound Name | 2,2-difluoropropyl 3-butoxyadamantane-1-carboxylate;2,2-difluoropropyl 3-ethoxyadamantane-1-carboxylate |
|---|---|
| PubChem CID | 123259647 |
| Molecular Formula | C34H52F4O6 |
| Molecular Weight | 632.78 g/mol |
| Exact Mass | 632.37 |
| IUPAC Name | 2,2-difluoropropyl 3-butoxyadamantane-1-carboxylate;2,2-difluoropropyl 3-ethoxyadamantane-1-carboxylate |
| SMILES | CCCCOC12CC3CC(C1)CC(C(=O)OCC(C)(F)F)(C3)C2.CCOC12CC3CC(C1)CC(C(=O)OCC(C)(F)F)(C3)C2 |
| InChI | InChI=1S/C18H28F2O3.C16H24F2O3/c1-3-4-5-23-18-9-13-6-14(10-18)8-17(7-13,11-18)15(21)22-12-16(2,19)20;1-3-21-16-7-11-4-12(8-16)6-15(5-11,9-16)13(19)20-10-14(2,17)18/h13-14H,3-12H2,1-2H3;11-12H,3-10H2,1-2H3 |
| InChIKey | BTYTUDWPMZURIN-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.78 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|