C20H21F9O4 — CID 137432134
2,2,3,3,4,4,5,5,5-nonafluoropentyl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate (PubChem CID 137432134) has the molecular formula C20H21F9O4 and a molecular weight of 496.37 g/mol. Its IUPAC name is 2,2,3,3,4,4,5,5,5-nonafluoropentyl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate.
| Compound Name | 2,2,3,3,4,4,5,5,5-nonafluoropentyl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 137432134 |
| Molecular Formula | C20H21F9O4 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | 2,2,3,3,4,4,5,5,5-nonafluoropentyl 3-(2-methylprop-2-enoyloxy)adamantane-1-carboxylate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C20H21F9O4/c1-10(2)13(30)33-16-6-11-3-12(7-16)5-15(4-11,8-16)14(31)32-9-17(21,22)18(23,24)19(25,26)20(27,28)29/h11-12H,1,3-9H2,2H3 |
| InChIKey | JZDMGJTWCJEHEN-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|