C20H23F7O5 — CID 121323934
[4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 121323934) has the molecular formula C20H23F7O5 and a molecular weight of 476.39 g/mol. Its IUPAC name is [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 121323934 |
| Molecular Formula | C20H23F7O5 |
| Molecular Weight | 476.39 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [4-[2-(2,2,3,3,4,4,4-heptafluorobutoxy)-2-oxoethoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)C(OCC(=O)OCC(F)(F)C(F)(F)C(F)(F)F)C(C3)C2 |
| InChI | InChI=1S/C20H23F7O5/c1-10(2)16(29)32-17-5-11-3-12(6-17)15(13(4-11)7-17)30-8-14(28)31-9-18(21,22)19(23,24)20(25,26)27/h11-13,15H,1,3-9H2,2H3 |
| InChIKey | HKXGHXRUBHMWDU-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|