C24H18F18O6 — CID 87413036
[5-(2-methylprop-2-enoyloxy)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)-2-adamantyl] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate (PubChem CID 87413036) has the molecular formula C24H18F18O6 and a molecular weight of 744.37 g/mol. Its IUPAC name is [5-(2-methylprop-2-enoyloxy)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)-2-adamantyl] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate.
| Compound Name | [5-(2-methylprop-2-enoyloxy)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)-2-adamantyl] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
|---|---|
| PubChem CID | 87413036 |
| Molecular Formula | C24H18F18O6 |
| Molecular Weight | 744.37 g/mol |
| Exact Mass | 744.08 |
| IUPAC Name | [5-(2-methylprop-2-enoyloxy)-2-(2,2,3,3,4,4,5,5,5-nonafluoropentanoyloxy)-2-adamantyl] 2,2,3,3,4,4,5,5,5-nonafluoropentanoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)C(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(C3)C2 |
| InChI | InChI=1S/C24H18F18O6/c1-8(2)12(43)46-15-5-9-3-10(6-15)16(11(4-9)7-15,47-13(44)17(25,26)19(29,30)21(33,34)23(37,38)39)48-14(45)18(27,28)20(31,32)22(35,36)24(40,41)42/h9-11H,1,3-7H2,2H3 |
| InChIKey | OQSINKBVLAKFLN-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.37 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|