C21H16F14O8 — CID 87413037
[2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 87413037) has the molecular formula C21H16F14O8 and a molecular weight of 662.32 g/mol. Its IUPAC name is [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 87413037 |
| Molecular Formula | C21H16F14O8 |
| Molecular Weight | 662.32 g/mol |
| Exact Mass | 662.06 |
| IUPAC Name | [2-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-bicyclo[2.2.1]heptanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC1C2CCC(C2)C1(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H16F14O8/c1-7(2)12(37)40-6-10(36)41-11-8-3-4-9(5-8)15(11,42-13(38)16(22,23)18(26,27)20(30,31)32)43-14(39)17(24,25)19(28,29)21(33,34)35/h8-9,11H,1,3-6H2,2H3 |
| InChIKey | IOCXZAHRLXHXEV-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|