C19H24F6O6 — CID 88577906
1-O-cyclohexyl 5-O-[4-(2-methylprop-2-enoyloxy)butyl] 2,2,3,3,4,4-hexafluoropentanedioate (PubChem CID 88577906) has the molecular formula C19H24F6O6 and a molecular weight of 462.38 g/mol. Its IUPAC name is 1-O-cyclohexyl 5-O-[4-(2-methylprop-2-enoyloxy)butyl] 2,2,3,3,4,4-hexafluoropentanedioate.
| Compound Name | 1-O-cyclohexyl 5-O-[4-(2-methylprop-2-enoyloxy)butyl] 2,2,3,3,4,4-hexafluoropentanedioate |
|---|---|
| PubChem CID | 88577906 |
| Molecular Formula | C19H24F6O6 |
| Molecular Weight | 462.38 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 1-O-cyclohexyl 5-O-[4-(2-methylprop-2-enoyloxy)butyl] 2,2,3,3,4,4-hexafluoropentanedioate |
| SMILES | C=C(C)C(=O)OCCCCOC(=O)C(F)(F)C(F)(F)C(F)(F)C(=O)OC1CCCCC1 |
| InChI | InChI=1S/C19H24F6O6/c1-12(2)14(26)29-10-6-7-11-30-15(27)17(20,21)19(24,25)18(22,23)16(28)31-13-8-4-3-5-9-13/h13H,1,3-11H2,2H3 |
| InChIKey | MJFYZSOINOUCTQ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|