C24H18F14O8 — CID 148530690
[11-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-(2-prop-2-enoyloxyacetyl)oxy-11-tetracyclo[5.3.1.03,9.05,9]undecanyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 148530690) has the molecular formula C24H18F14O8 and a molecular weight of 700.37 g/mol. Its IUPAC name is [11-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-(2-prop-2-enoyloxyacetyl)oxy-11-tetracyclo[5.3.1.03,9.05,9]undecanyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [11-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-(2-prop-2-enoyloxyacetyl)oxy-11-tetracyclo[5.3.1.03,9.05,9]undecanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 148530690 |
| Molecular Formula | C24H18F14O8 |
| Molecular Weight | 700.37 g/mol |
| Exact Mass | 700.08 |
| IUPAC Name | [11-(2,2,3,3,4,4,4-heptafluorobutanoyloxy)-3-(2-prop-2-enoyloxyacetyl)oxy-11-tetracyclo[5.3.1.03,9.05,9]undecanyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C=CC(=O)OCC(=O)OC12CC3CC14CC(CC4C2)C3(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H18F14O8/c1-2-12(39)43-8-13(40)44-17-6-9-3-10-4-16(9,17)5-11(7-17)18(10,45-14(41)19(25,26)21(29,30)23(33,34)35)46-15(42)20(27,28)22(31,32)24(36,37)38/h2,9-11H,1,3-8H2 |
| InChIKey | MQFNDSGAZWLDAR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.37 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|