C24H23F11O8 — CID 87154505
[5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(2,2,3,3-tetrafluorobutanoyloxy)-2-adamantyl] 2,2,3,3,4,4,4-heptafluorobutanoate (PubChem CID 87154505) has the molecular formula C24H23F11O8 and a molecular weight of 648.42 g/mol. Its IUPAC name is [5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(2,2,3,3-tetrafluorobutanoyloxy)-2-adamantyl] 2,2,3,3,4,4,4-heptafluorobutanoate.
| Compound Name | [5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(2,2,3,3-tetrafluorobutanoyloxy)-2-adamantyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
|---|---|
| PubChem CID | 87154505 |
| Molecular Formula | C24H23F11O8 |
| Molecular Weight | 648.42 g/mol |
| Exact Mass | 648.12 |
| IUPAC Name | [5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-(2,2,3,3-tetrafluorobutanoyloxy)-2-adamantyl] 2,2,3,3,4,4,4-heptafluorobutanoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C1)C(OC(=O)C(F)(F)C(C)(F)F)(OC(=O)C(F)(F)C(F)(F)C(F)(F)F)C(C3)C2 |
| InChI | InChI=1S/C24H23F11O8/c1-10(2)15(37)40-9-14(36)41-19-6-11-4-12(7-19)20(13(5-11)8-19,42-16(38)21(27,28)18(3,25)26)43-17(39)22(29,30)23(31,32)24(33,34)35/h11-13H,1,4-9H2,2-3H3 |
| InChIKey | IUOCACWGTFFXHB-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.42 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|