C26H36O6 — CID 167052818
cyclohexyl (E)-2-methyl-3-[5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-adamantyl]prop-2-enoate (PubChem CID 167052818) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is cyclohexyl (E)-2-methyl-3-[5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-adamantyl]prop-2-enoate.
| Compound Name | cyclohexyl (E)-2-methyl-3-[5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-adamantyl]prop-2-enoate |
|---|---|
| PubChem CID | 167052818 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | cyclohexyl (E)-2-methyl-3-[5-[2-(2-methylprop-2-enoyloxy)acetyl]oxy-2-adamantyl]prop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C1)C(/C=C(\C)C(=O)OC1CCCCC1)C(C3)C2 |
| InChI | InChI=1S/C26H36O6/c1-16(2)24(28)30-15-23(27)32-26-12-18-10-19(13-26)22(20(11-18)14-26)9-17(3)25(29)31-21-7-5-4-6-8-21/h9,18-22H,1,4-8,10-15H2,2-3H3/b17-9+ |
| InChIKey | NTQBIDOSGHEGQX-RQZCQDPDSA-N |
| XLogP | 4.67 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|