C34H55F3O8 — CID 129118933
[2-[[3-[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-5-[2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate (PubChem CID 129118933) has the molecular formula C34H55F3O8 and a molecular weight of 648.80 g/mol. Its IUPAC name is [2-[[3-[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-5-[2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate.
| Compound Name | [2-[[3-[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-5-[2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118933 |
| Molecular Formula | C34H55F3O8 |
| Molecular Weight | 648.80 g/mol |
| Exact Mass | 648.38 |
| IUPAC Name | [2-[[3-[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-5-[2-(4,4,4-trifluoro-3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl]oxy]-2-oxoethyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(=O)OC12CC3CC(C(C)(C)OC(C)(C)C(C)(C)O)(C1)CC(C(C)(C)OC(C)(C)C(C)(O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C34H55F3O8/c1-21(2)24(39)42-17-23(38)43-33-16-22-14-31(19-33,28(9,10)44-26(5,6)25(3,4)40)18-32(15-22,20-33)29(11,12)45-27(7,8)30(13,41)34(35,36)37/h22,40-41H,1,14-20H2,2-13H3 |
| InChIKey | JBFFGSVJEJZPBE-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.80 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|