C41H74O8 — CID 129118956
[3,5,7-tris[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 129118956) has the molecular formula C41H74O8 and a molecular weight of 695.03 g/mol. Its IUPAC name is [3,5,7-tris[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5,7-tris[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118956 |
| Molecular Formula | C41H74O8 |
| Molecular Weight | 695.03 g/mol |
| Exact Mass | 694.54 |
| IUPAC Name | [3,5,7-tris[2-(3-hydroxy-2,3-dimethylbutan-2-yl)oxypropan-2-yl]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3(C(C)(C)OC(C)(C)C(C)(C)O)CC(C(C)(C)OC(C)(C)C(C)(C)O)(C1)CC(C(C)(C)OC(C)(C)C(C)(C)O)(C2)C3 |
| InChI | InChI=1S/C41H74O8/c1-27(2)28(42)46-41-24-38(35(15,16)47-32(9,10)29(3,4)43)21-39(25-41,36(17,18)48-33(11,12)30(5,6)44)23-40(22-38,26-41)37(19,20)49-34(13,14)31(7,8)45/h43-45H,1,21-26H2,2-20H3 |
| InChIKey | MYCHBSXUXRXOTK-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 114.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.03 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|