C32H56O6 — CID 129118948
[3,5-bis[3-(2-hydroxy-2-methylpropoxy)pentan-3-yl]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 129118948) has the molecular formula C32H56O6 and a molecular weight of 536.79 g/mol. Its IUPAC name is [3,5-bis[3-(2-hydroxy-2-methylpropoxy)pentan-3-yl]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[3-(2-hydroxy-2-methylpropoxy)pentan-3-yl]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 129118948 |
| Molecular Formula | C32H56O6 |
| Molecular Weight | 536.79 g/mol |
| Exact Mass | 536.41 |
| IUPAC Name | [3,5-bis[3-(2-hydroxy-2-methylpropoxy)pentan-3-yl]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C(CC)(CC)OCC(C)(C)O)(C1)CC(C(CC)(CC)OCC(C)(C)O)(C3)C2 |
| InChI | InChI=1S/C32H56O6/c1-11-31(12-2,36-21-26(7,8)34)28-15-24-16-29(18-28,32(13-3,14-4)37-22-27(9,10)35)20-30(17-24,19-28)38-25(33)23(5)6/h24,34-35H,5,11-22H2,1-4,6-10H3 |
| InChIKey | AUEVNDDDZYUFCF-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.79 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|