C14H19BrO2 — CID 70404847
(3-bromo-1-adamantyl) 2-methylprop-2-enoate (PubChem CID 70404847) has the molecular formula C14H19BrO2 and a molecular weight of 299.21 g/mol. Its IUPAC name is (3-bromo-1-adamantyl) 2-methylprop-2-enoate.
| Compound Name | (3-bromo-1-adamantyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 70404847 |
| Molecular Formula | C14H19BrO2 |
| Molecular Weight | 299.21 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | (3-bromo-1-adamantyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(CC(Br)(C3)C1)C2 |
| InChI | InChI=1S/C14H19BrO2/c1-9(2)12(16)17-14-6-10-3-11(7-14)5-13(15,4-10)8-14/h10-11H,1,3-8H2,2H3 |
| InChIKey | ALUZRFBTSOCMCY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.21 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|