C18H30NO3+ — CID 140768698
3-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxy]butylazanium (PubChem CID 140768698) has the molecular formula C18H30NO3+ and a molecular weight of 308.44 g/mol. Its IUPAC name is 3-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxy]butylazanium.
| Compound Name | 3-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxy]butylazanium |
|---|---|
| PubChem CID | 140768698 |
| Molecular Formula | C18H30NO3+ |
| Molecular Weight | 308.44 g/mol |
| Exact Mass | 308.22 |
| IUPAC Name | 3-[[3-(2-methylprop-2-enoyloxy)-1-adamantyl]oxy]butylazanium |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)CC(OC(C)CC[NH3+])(C3)C2 |
| InChI | InChI=1S/C18H29NO3/c1-12(2)16(20)22-18-9-14-6-15(10-18)8-17(7-14,11-18)21-13(3)4-5-19/h13-15H,1,4-11,19H2,2-3H3/p+1 |
| InChIKey | OYPWBMXAWXTNOO-UHFFFAOYSA-O |
| XLogP | 2.23 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.44 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|