C19H28NO9S2- — CID 58491372
[2-[[3-[1-(2-methylprop-2-enoyloxy)ethoxy]-1-adamantyl]oxy]-2-oxoethyl]sulfonyl-methylsulfonylazanide (PubChem CID 58491372) has the molecular formula C19H28NO9S2- and a molecular weight of 478.57 g/mol. Its IUPAC name is [2-[[3-[1-(2-methylprop-2-enoyloxy)ethoxy]-1-adamantyl]oxy]-2-oxoethyl]sulfonyl-methylsulfonylazanide.
| Compound Name | [2-[[3-[1-(2-methylprop-2-enoyloxy)ethoxy]-1-adamantyl]oxy]-2-oxoethyl]sulfonyl-methylsulfonylazanide |
|---|---|
| PubChem CID | 58491372 |
| Molecular Formula | C19H28NO9S2- |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | [2-[[3-[1-(2-methylprop-2-enoyloxy)ethoxy]-1-adamantyl]oxy]-2-oxoethyl]sulfonyl-methylsulfonylazanide |
| SMILES | C=C(C)C(=O)OC(C)OC12CC3CC(CC(OC(=O)CS(=O)(=O)[N-]S(C)(=O)=O)(C3)C1)C2 |
| InChI | InChI=1S/C19H28NO9S2/c1-12(2)17(22)27-13(3)28-18-6-14-5-15(7-18)9-19(8-14,11-18)29-16(21)10-31(25,26)20-30(4,23)24/h13-15H,1,5-11H2,2-4H3/q-1 |
| InChIKey | QYBIZKHFRKRNID-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 144.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|