C24H36O5 — CID 102589198
[(5S,7R)-3-[2-(1-cyclohexyloxyethoxy)-2-oxoethyl]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 102589198) has the molecular formula C24H36O5 and a molecular weight of 404.55 g/mol. Its IUPAC name is [(5S,7R)-3-[2-(1-cyclohexyloxyethoxy)-2-oxoethyl]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [(5S,7R)-3-[2-(1-cyclohexyloxyethoxy)-2-oxoethyl]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102589198 |
| Molecular Formula | C24H36O5 |
| Molecular Weight | 404.55 g/mol |
| Exact Mass | 404.26 |
| IUPAC Name | [(5S,7R)-3-[2-(1-cyclohexyloxyethoxy)-2-oxoethyl]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12C[C@@H]3C[C@@H](CC(CC(=O)OC(C)OC4CCCCC4)(C3)C1)C2 |
| InChI | InChI=1S/C24H36O5/c1-16(2)22(26)29-24-12-18-9-19(13-24)11-23(10-18,15-24)14-21(25)28-17(3)27-20-7-5-4-6-8-20/h17-20H,1,4-15H2,2-3H3/t17?,18-,19+,23?,24? |
| InChIKey | LHDCXGHLJHVTSJ-JEBULOSOSA-N |
| XLogP | 5.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|