C16H21ClO5 — CID 58165641
[3-(2-chloroacetyl)oxy-5-hydroxy-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 58165641) has the molecular formula C16H21ClO5 and a molecular weight of 328.79 g/mol. Its IUPAC name is [3-(2-chloroacetyl)oxy-5-hydroxy-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3-(2-chloroacetyl)oxy-5-hydroxy-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 58165641 |
| Molecular Formula | C16H21ClO5 |
| Molecular Weight | 328.79 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | [3-(2-chloroacetyl)oxy-5-hydroxy-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(O)(CC(OC(=O)CCl)(C3)C1)C2 |
| InChI | InChI=1S/C16H21ClO5/c1-10(2)13(19)22-16-5-11-3-14(20,8-16)7-15(4-11,9-16)21-12(18)6-17/h11,20H,1,3-9H2,2H3 |
| InChIKey | FBPWNBSGEMZRRD-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|