C16H21ClO4 — CID 130332824
[4-(2-chloroacetyl)oxy-4-methyl-1-tricyclo[3.3.1.03,7]nonanyl] 2-methylprop-2-enoate (PubChem CID 130332824) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is [4-(2-chloroacetyl)oxy-4-methyl-1-tricyclo[3.3.1.03,7]nonanyl] 2-methylprop-2-enoate.
| Compound Name | [4-(2-chloroacetyl)oxy-4-methyl-1-tricyclo[3.3.1.03,7]nonanyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 130332824 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | [4-(2-chloroacetyl)oxy-4-methyl-1-tricyclo[3.3.1.03,7]nonanyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C1)C(C)(OC(=O)CCl)C3C2 |
| InChI | InChI=1S/C16H21ClO4/c1-9(2)14(19)21-16-5-10-4-11(6-16)15(3,12(10)7-16)20-13(18)8-17/h10-12H,1,4-8H2,2-3H3 |
| InChIKey | KXACZYKJDHSYEC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|