C17H26O2 — CID 148584656
(8-ethyl-8-tricyclo[5.3.1.04,9]undecanyl) 2-methylprop-2-enoate (PubChem CID 148584656) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is (8-ethyl-8-tricyclo[5.3.1.04,9]undecanyl) 2-methylprop-2-enoate.
| Compound Name | (8-ethyl-8-tricyclo[5.3.1.04,9]undecanyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 148584656 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | (8-ethyl-8-tricyclo[5.3.1.04,9]undecanyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CC)C2CCC3CCC(C2)CC31 |
| InChI | InChI=1S/C17H26O2/c1-4-17(19-16(18)11(2)3)14-8-7-13-6-5-12(9-14)10-15(13)17/h12-15H,2,4-10H2,1,3H3 |
| InChIKey | MZLHWAYQTLCLLX-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|