C42H72O6 — CID 68636162
[3,5-bis[7-(2-butyloxetan-2-yl)heptoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 68636162) has the molecular formula C42H72O6 and a molecular weight of 673.03 g/mol. Its IUPAC name is [3,5-bis[7-(2-butyloxetan-2-yl)heptoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[7-(2-butyloxetan-2-yl)heptoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 68636162 |
| Molecular Formula | C42H72O6 |
| Molecular Weight | 673.03 g/mol |
| Exact Mass | 672.53 |
| IUPAC Name | [3,5-bis[7-(2-butyloxetan-2-yl)heptoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(OCCCCCCCC4(CCCC)CCO4)(CC(OCCCCCCCC4(CCCC)CCO4)(C3)C1)C2 |
| InChI | InChI=1S/C42H72O6/c1-5-7-19-38(23-27-46-38)21-15-11-9-13-17-25-44-40-29-36-30-41(32-40,34-42(31-36,33-40)48-37(43)35(3)4)45-26-18-14-10-12-16-22-39(20-8-6-2)24-28-47-39/h36H,3,5-34H2,1-2,4H3 |
| InChIKey | NAZRFHZXPRHZTL-UHFFFAOYSA-N |
| XLogP | 10.73 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.03 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|