C47H80O8 — CID 68634462
3-[3,5-bis[6-(2-ethyloxetan-2-yl)hexoxy]-1-adamantyl]-3-[6-(2-ethyloxetan-2-yl)hexoxy]-2-methylprop-2-enoic acid (PubChem CID 68634462) has the molecular formula C47H80O8 and a molecular weight of 773.15 g/mol. Its IUPAC name is 3-[3,5-bis[6-(2-ethyloxetan-2-yl)hexoxy]-1-adamantyl]-3-[6-(2-ethyloxetan-2-yl)hexoxy]-2-methylprop-2-enoic acid.
| Compound Name | 3-[3,5-bis[6-(2-ethyloxetan-2-yl)hexoxy]-1-adamantyl]-3-[6-(2-ethyloxetan-2-yl)hexoxy]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68634462 |
| Molecular Formula | C47H80O8 |
| Molecular Weight | 773.15 g/mol |
| Exact Mass | 772.59 |
| IUPAC Name | 3-[3,5-bis[6-(2-ethyloxetan-2-yl)hexoxy]-1-adamantyl]-3-[6-(2-ethyloxetan-2-yl)hexoxy]-2-methylprop-2-enoic acid |
| SMILES | CCC1(CCCCCCOC(=C(C)C(=O)O)C23CC4CC(OCCCCCCC5(CC)CCO5)(CC(OCCCCCCC5(CC)CCO5)(C4)C2)C3)CCO1 |
| InChI | InChI=1S/C47H80O8/c1-5-43(23-29-53-43)20-14-8-11-17-26-50-40(38(4)41(48)49)42-32-39-33-46(35-42,51-27-18-12-9-15-21-44(6-2)24-30-54-44)37-47(34-39,36-42)52-28-19-13-10-16-22-45(7-3)25-31-55-45/h39H,5-37H2,1-4H3,(H,48,49) |
| InChIKey | ZZZLUADAHATRFG-UHFFFAOYSA-N |
| XLogP | 11.42 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 773.15 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|