C32H52O6 — CID 68635532
2-methyl-3-[5-(3-methyloxetan-3-yl)pentoxy]-3-[3-[5-(3-methyloxetan-3-yl)pentoxy]-1-adamantyl]prop-2-enoic acid (PubChem CID 68635532) has the molecular formula C32H52O6 and a molecular weight of 532.76 g/mol. Its IUPAC name is 2-methyl-3-[5-(3-methyloxetan-3-yl)pentoxy]-3-[3-[5-(3-methyloxetan-3-yl)pentoxy]-1-adamantyl]prop-2-enoic acid.
| Compound Name | 2-methyl-3-[5-(3-methyloxetan-3-yl)pentoxy]-3-[3-[5-(3-methyloxetan-3-yl)pentoxy]-1-adamantyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 68635532 |
| Molecular Formula | C32H52O6 |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.38 |
| IUPAC Name | 2-methyl-3-[5-(3-methyloxetan-3-yl)pentoxy]-3-[3-[5-(3-methyloxetan-3-yl)pentoxy]-1-adamantyl]prop-2-enoic acid |
| SMILES | CC(C(=O)O)=C(OCCCCCC1(C)COC1)C12CC3CC(CC(OCCCCCC4(C)COC4)(C3)C1)C2 |
| InChI | InChI=1S/C32H52O6/c1-24(28(33)34)27(37-12-8-4-6-10-29(2)20-35-21-29)31-15-25-14-26(16-31)18-32(17-25,19-31)38-13-9-5-7-11-30(3)22-36-23-30/h25-26H,4-23H2,1-3H3,(H,33,34) |
| InChIKey | COBHNVVNNAFGLN-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|