C40H68O6 — CID 68635926
3-[6-(3-butyloxetan-3-yl)hexoxy]-3-[3-[6-(3-butyloxetan-3-yl)hexoxy]-1-adamantyl]-2-methylprop-2-enoic acid (PubChem CID 68635926) has the molecular formula C40H68O6 and a molecular weight of 644.98 g/mol. Its IUPAC name is 3-[6-(3-butyloxetan-3-yl)hexoxy]-3-[3-[6-(3-butyloxetan-3-yl)hexoxy]-1-adamantyl]-2-methylprop-2-enoic acid.
| Compound Name | 3-[6-(3-butyloxetan-3-yl)hexoxy]-3-[3-[6-(3-butyloxetan-3-yl)hexoxy]-1-adamantyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 68635926 |
| Molecular Formula | C40H68O6 |
| Molecular Weight | 644.98 g/mol |
| Exact Mass | 644.50 |
| IUPAC Name | 3-[6-(3-butyloxetan-3-yl)hexoxy]-3-[3-[6-(3-butyloxetan-3-yl)hexoxy]-1-adamantyl]-2-methylprop-2-enoic acid |
| SMILES | CCCCC1(CCCCCCOC(=C(C)C(=O)O)C23CC4CC(CC(OCCCCCCC5(CCCC)COC5)(C4)C2)C3)COC1 |
| InChI | InChI=1S/C40H68O6/c1-4-6-16-37(28-43-29-37)18-12-8-10-14-20-45-35(32(3)36(41)42)39-23-33-22-34(24-39)26-40(25-33,27-39)46-21-15-11-9-13-19-38(17-7-5-2)30-44-31-38/h33-34H,4-31H2,1-3H3,(H,41,42) |
| InChIKey | FCJFNKWCKAROFP-UHFFFAOYSA-N |
| XLogP | 10.03 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.98 |
| LogP ≤ 5 | 10.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|