C22H34O4 — CID 68635341
2-(1-adamantylmethyl)-3-[(2-butyloxetan-2-yl)methoxy]prop-2-enoic acid (PubChem CID 68635341) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-(1-adamantylmethyl)-3-[(2-butyloxetan-2-yl)methoxy]prop-2-enoic acid.
| Compound Name | 2-(1-adamantylmethyl)-3-[(2-butyloxetan-2-yl)methoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 68635341 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | 2-(1-adamantylmethyl)-3-[(2-butyloxetan-2-yl)methoxy]prop-2-enoic acid |
| SMILES | CCCCC1(COC=C(CC23CC4CC(CC(C4)C2)C3)C(=O)O)CCO1 |
| InChI | InChI=1S/C22H34O4/c1-2-3-4-22(5-6-26-22)15-25-14-19(20(23)24)13-21-10-16-7-17(11-21)9-18(8-16)12-21/h14,16-18H,2-13,15H2,1H3,(H,23,24) |
| InChIKey | IACMLVACAQTCNJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|