C27H44O4 — CID 68635509
2-(1-adamantylmethyl)-3-[6-(2-butyloxetan-2-yl)hexoxy]prop-2-enoic acid (PubChem CID 68635509) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is 2-(1-adamantylmethyl)-3-[6-(2-butyloxetan-2-yl)hexoxy]prop-2-enoic acid.
| Compound Name | 2-(1-adamantylmethyl)-3-[6-(2-butyloxetan-2-yl)hexoxy]prop-2-enoic acid |
|---|---|
| PubChem CID | 68635509 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | 2-(1-adamantylmethyl)-3-[6-(2-butyloxetan-2-yl)hexoxy]prop-2-enoic acid |
| SMILES | CCCCC1(CCCCCCOC=C(CC23CC4CC(CC(C4)C2)C3)C(=O)O)CCO1 |
| InChI | InChI=1S/C27H44O4/c1-2-3-8-27(10-12-31-27)9-6-4-5-7-11-30-20-24(25(28)29)19-26-16-21-13-22(17-26)15-23(14-21)18-26/h20-23H,2-19H2,1H3,(H,28,29) |
| InChIKey | CQMZGZVYOGDGCJ-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|