C34H56O6 — CID 68634826
[3,5-bis[5-(2-ethyloxetan-2-yl)pentoxy]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 68634826) has the molecular formula C34H56O6 and a molecular weight of 560.82 g/mol. Its IUPAC name is [3,5-bis[5-(2-ethyloxetan-2-yl)pentoxy]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[5-(2-ethyloxetan-2-yl)pentoxy]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 68634826 |
| Molecular Formula | C34H56O6 |
| Molecular Weight | 560.82 g/mol |
| Exact Mass | 560.41 |
| IUPAC Name | [3,5-bis[5-(2-ethyloxetan-2-yl)pentoxy]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(OCCCCCC4(CC)CCO4)(CC(OCCCCCC4(CC)CCO4)(C3)C1)C2 |
| InChI | InChI=1S/C34H56O6/c1-5-30(15-19-38-30)13-9-7-11-17-36-32-21-28-22-33(24-32,26-34(23-28,25-32)40-29(35)27(3)4)37-18-12-8-10-14-31(6-2)16-20-39-31/h28H,3,5-26H2,1-2,4H3 |
| InChIKey | QHFWNJXGCXFACW-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.82 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|