C28H42F6O6 — CID 158798358
[3,5-bis[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]-1-adamantyl] 2-methylprop-2-enoate (PubChem CID 158798358) has the molecular formula C28H42F6O6 and a molecular weight of 588.63 g/mol. Its IUPAC name is [3,5-bis[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]-1-adamantyl] 2-methylprop-2-enoate.
| Compound Name | [3,5-bis[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]-1-adamantyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158798358 |
| Molecular Formula | C28H42F6O6 |
| Molecular Weight | 588.63 g/mol |
| Exact Mass | 588.29 |
| IUPAC Name | [3,5-bis[2-(3,3,3-trifluoro-2-hydroxy-2-methylpropoxy)propan-2-yl]-1-adamantyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC12CC3CC(C(C)(C)OCC(C)(O)C(F)(F)F)(C1)CC(C(C)(C)OCC(C)(O)C(F)(F)F)(C3)C2 |
| InChI | InChI=1S/C28H42F6O6/c1-17(2)19(35)40-26-11-18-9-24(13-26,20(3,4)38-15-22(7,36)27(29,30)31)12-25(10-18,14-26)21(5,6)39-16-23(8,37)28(32,33)34/h18,36-37H,1,9-16H2,2-8H3 |
| InChIKey | RUPYOENSEBONER-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.63 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|