C16H20O6 — CID 147760205
[2-[(5,7-dihydroxy-1-tetracyclo[5.3.1.03,9.05,9]undecanyl)oxy]-2-oxoethyl] prop-2-enoate (PubChem CID 147760205) has the molecular formula C16H20O6 and a molecular weight of 308.33 g/mol. Its IUPAC name is [2-[(5,7-dihydroxy-1-tetracyclo[5.3.1.03,9.05,9]undecanyl)oxy]-2-oxoethyl] prop-2-enoate.
| Compound Name | [2-[(5,7-dihydroxy-1-tetracyclo[5.3.1.03,9.05,9]undecanyl)oxy]-2-oxoethyl] prop-2-enoate |
|---|---|
| PubChem CID | 147760205 |
| Molecular Formula | C16H20O6 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | [2-[(5,7-dihydroxy-1-tetracyclo[5.3.1.03,9.05,9]undecanyl)oxy]-2-oxoethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OC12CC3CC4(O)CC(O)(C1)CC34C2 |
| InChI | InChI=1S/C16H20O6/c1-2-11(17)21-5-12(18)22-14-3-10-4-16(20)8-13(19,6-14)7-15(10,16)9-14/h2,10,19-20H,1,3-9H2 |
| InChIKey | HDXMUFSMNPAHFT-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|