C23H28F2O11S — CID 88946649
1,1-difluoro-2-[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carbonyl]oxyethanesulfonic acid (PubChem CID 88946649) has the molecular formula C23H28F2O11S and a molecular weight of 550.53 g/mol. Its IUPAC name is 1,1-difluoro-2-[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carbonyl]oxyethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carbonyl]oxyethanesulfonic acid |
|---|---|
| PubChem CID | 88946649 |
| Molecular Formula | C23H28F2O11S |
| Molecular Weight | 550.53 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 1,1-difluoro-2-[3-hydroxy-5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]adamantane-1-carbonyl]oxyethanesulfonic acid |
| SMILES | O=C(COC12CC3CC(O)(C1)CC(C(=O)OCC(F)(F)S(=O)(=O)O)(C3)C2)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C23H28F2O11S/c24-23(25,37(30,31)32)10-33-19(28)20-3-11-4-21(29,7-20)9-22(5-11,8-20)34-6-15(26)35-16-12-1-13-14(2-12)18(27)36-17(13)16/h11-14,16-17,29H,1-10H2,(H,30,31,32) |
| InChIKey | CPLULVSYRBMLLJ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 162.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.53 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|