C22H26F2O10S — CID 88942514
1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-2-adamantyl]oxy]ethanesulfonic acid (PubChem CID 88942514) has the molecular formula C22H26F2O10S and a molecular weight of 520.50 g/mol. Its IUPAC name is 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-2-adamantyl]oxy]ethanesulfonic acid.
| Compound Name | 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-2-adamantyl]oxy]ethanesulfonic acid |
|---|---|
| PubChem CID | 88942514 |
| Molecular Formula | C22H26F2O10S |
| Molecular Weight | 520.50 g/mol |
| Exact Mass | 520.12 |
| IUPAC Name | 1,1-difluoro-2-oxo-2-[[5-[2-oxo-2-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]ethoxy]-2-adamantyl]oxy]ethanesulfonic acid |
| SMILES | O=C(COC12CC3CC(C1)C(OC(=O)C(F)(F)S(=O)(=O)O)C(C3)C2)OC1C2CC3C(=O)OC1C3C2 |
| InChI | InChI=1S/C22H26F2O10S/c23-22(24,35(28,29)30)20(27)34-16-11-1-9-2-12(16)7-21(5-9,6-11)31-8-15(25)32-17-10-3-13-14(4-10)19(26)33-18(13)17/h9-14,16-18H,1-8H2,(H,28,29,30) |
| InChIKey | UDEONNVGNHULJH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 142.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.50 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|