C17H22F4O8S — CID 176875293
1,1,2,2-tetrafluoro-4-[2-methyl-4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butan-2-yl]oxybutane-1-sulfonic acid (PubChem CID 176875293) has the molecular formula C17H22F4O8S and a molecular weight of 462.41 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-methyl-4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butan-2-yl]oxybutane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-methyl-4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butan-2-yl]oxybutane-1-sulfonic acid |
|---|---|
| PubChem CID | 176875293 |
| Molecular Formula | C17H22F4O8S |
| Molecular Weight | 462.41 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-methyl-4-oxo-4-[(5-oxo-4-oxatricyclo[4.2.1.03,7]nonan-2-yl)oxy]butan-2-yl]oxybutane-1-sulfonic acid |
| SMILES | CC(C)(CC(=O)OC1C2CC3C(=O)OC1C3C2)OCCC(F)(F)C(F)(F)S(=O)(=O)O |
| InChI | InChI=1S/C17H22F4O8S/c1-15(2,27-4-3-16(18,19)17(20,21)30(24,25)26)7-11(22)28-12-8-5-9-10(6-8)14(23)29-13(9)12/h8-10,12-13H,3-7H2,1-2H3,(H,24,25,26) |
| InChIKey | MZDVVCTVNIBPIV-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.41 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|